C20H21NO7S — CID 8700570
(3-methoxycarbonylphenyl)methyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate (PubChem CID 8700570) has the molecular formula C20H21NO7S and a molecular weight of 419.46 g/mol. Its IUPAC name is (3-methoxycarbonylphenyl)methyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate.
| Compound Name | (3-methoxycarbonylphenyl)methyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 8700570 |
| Molecular Formula | C20H21NO7S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | (3-methoxycarbonylphenyl)methyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
| SMILES | COC(=O)c1cccc(COC(=O)c2ccc(OC)c(S(=O)(=O)NC3CC3)c2)c1 |
| InChI | InChI=1S/C20H21NO7S/c1-26-17-9-6-15(11-18(17)29(24,25)21-16-7-8-16)20(23)28-12-13-4-3-5-14(10-13)19(22)27-2/h3-6,9-11,16,21H,7-8,12H2,1-2H3 |
| InChIKey | RHJLRVGGNKTZNK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |