C19H18N2O6S — CID 8700583
1,3-benzoxazol-2-ylmethyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate (PubChem CID 8700583) has the molecular formula C19H18N2O6S and a molecular weight of 402.43 g/mol. Its IUPAC name is 1,3-benzoxazol-2-ylmethyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate.
| Compound Name | 1,3-benzoxazol-2-ylmethyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 8700583 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 1,3-benzoxazol-2-ylmethyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCc2nc3ccccc3o2)cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C19H18N2O6S/c1-25-16-9-6-12(10-17(16)28(23,24)21-13-7-8-13)19(22)26-11-18-20-14-4-2-3-5-15(14)27-18/h2-6,9-10,13,21H,7-8,11H2,1H3 |
| InChIKey | SQZFDAXZSMAMJN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |