C20H20N2O6S — CID 27702853
2-(4-cyanophenoxy)ethyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate (PubChem CID 27702853) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)ethyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate.
| Compound Name | 2-(4-cyanophenoxy)ethyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 27702853 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 2-(4-cyanophenoxy)ethyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCCOc2ccc(C#N)cc2)cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C20H20N2O6S/c1-26-18-9-4-15(12-19(18)29(24,25)22-16-5-6-16)20(23)28-11-10-27-17-7-2-14(13-21)3-8-17/h2-4,7-9,12,16,22H,5-6,10-11H2,1H3 |
| InChIKey | IRFFMSKEDQTSLU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|