C18H16BrNO5 — CID 27988560
2-(4-cyanophenoxy)ethyl 4-bromo-3,5-dimethoxybenzoate (PubChem CID 27988560) has the molecular formula C18H16BrNO5 and a molecular weight of 406.23 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)ethyl 4-bromo-3,5-dimethoxybenzoate.
| Compound Name | 2-(4-cyanophenoxy)ethyl 4-bromo-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 27988560 |
| Molecular Formula | C18H16BrNO5 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 2-(4-cyanophenoxy)ethyl 4-bromo-3,5-dimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCCOc2ccc(C#N)cc2)cc(OC)c1Br |
| InChI | InChI=1S/C18H16BrNO5/c1-22-15-9-13(10-16(23-2)17(15)19)18(21)25-8-7-24-14-5-3-12(11-20)4-6-14/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | UDGHFXFHQQCWLM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|