C25H21ClN2O6 — CID 42445805
2-(4-cyanophenoxy)ethyl 2-[(2-chlorobenzoyl)amino]-4,5-dimethoxybenzoate (PubChem CID 42445805) has the molecular formula C25H21ClN2O6 and a molecular weight of 480.90 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)ethyl 2-[(2-chlorobenzoyl)amino]-4,5-dimethoxybenzoate.
| Compound Name | 2-(4-cyanophenoxy)ethyl 2-[(2-chlorobenzoyl)amino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 42445805 |
| Molecular Formula | C25H21ClN2O6 |
| Molecular Weight | 480.90 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 2-(4-cyanophenoxy)ethyl 2-[(2-chlorobenzoyl)amino]-4,5-dimethoxybenzoate |
| SMILES | COc1cc(NC(=O)c2ccccc2Cl)c(C(=O)OCCOc2ccc(C#N)cc2)cc1OC |
| InChI | InChI=1S/C25H21ClN2O6/c1-31-22-13-19(25(30)34-12-11-33-17-9-7-16(15-27)8-10-17)21(14-23(22)32-2)28-24(29)18-5-3-4-6-20(18)26/h3-10,13-14H,11-12H2,1-2H3,(H,28,29) |
| InChIKey | QXXXFNQVCBVPEA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 106.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.90 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|