C26H25ClN2O6 — CID 42445888
[2-(2-ethylanilino)-2-oxoethyl] 2-[(2-chlorobenzoyl)amino]-4,5-dimethoxybenzoate (PubChem CID 42445888) has the molecular formula C26H25ClN2O6 and a molecular weight of 496.95 g/mol. Its IUPAC name is [2-(2-ethylanilino)-2-oxoethyl] 2-[(2-chlorobenzoyl)amino]-4,5-dimethoxybenzoate.
| Compound Name | [2-(2-ethylanilino)-2-oxoethyl] 2-[(2-chlorobenzoyl)amino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 42445888 |
| Molecular Formula | C26H25ClN2O6 |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | [2-(2-ethylanilino)-2-oxoethyl] 2-[(2-chlorobenzoyl)amino]-4,5-dimethoxybenzoate |
| SMILES | CCc1ccccc1NC(=O)COC(=O)c1cc(OC)c(OC)cc1NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C26H25ClN2O6/c1-4-16-9-5-8-12-20(16)28-24(30)15-35-26(32)18-13-22(33-2)23(34-3)14-21(18)29-25(31)17-10-6-7-11-19(17)27/h5-14H,4,15H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | NXBBSZTXYREVBP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |