C32H29ClN2O6 — CID 4844887
[2-(dibenzylamino)-2-oxoethyl] 2-[(2-chlorobenzoyl)amino]-4,5-dimethoxybenzoate (PubChem CID 4844887) has the molecular formula C32H29ClN2O6 and a molecular weight of 573.05 g/mol. Its IUPAC name is [2-(dibenzylamino)-2-oxoethyl] 2-[(2-chlorobenzoyl)amino]-4,5-dimethoxybenzoate.
| Compound Name | [2-(dibenzylamino)-2-oxoethyl] 2-[(2-chlorobenzoyl)amino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 4844887 |
| Molecular Formula | C32H29ClN2O6 |
| Molecular Weight | 573.05 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | [2-(dibenzylamino)-2-oxoethyl] 2-[(2-chlorobenzoyl)amino]-4,5-dimethoxybenzoate |
| SMILES | COc1cc(NC(=O)c2ccccc2Cl)c(C(=O)OCC(=O)N(Cc2ccccc2)Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C32H29ClN2O6/c1-39-28-17-25(27(18-29(28)40-2)34-31(37)24-15-9-10-16-26(24)33)32(38)41-21-30(36)35(19-22-11-5-3-6-12-22)20-23-13-7-4-8-14-23/h3-18H,19-21H2,1-2H3,(H,34,37) |
| InChIKey | XJJXEMIERPCTDA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.05 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |