About [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate
[2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate (PubChem CID 16528414) has the molecular formula C27H29NO6
and a molecular weight of 463.53 g/mol. Its IUPAC name is [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate.
Molecular Properties
| Compound Name | [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate |
| PubChem CID | 16528414 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate |
| SMILES | COc1cc(OC)c(C(=O)OCC(=O)N(CCc2ccccc2)Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C27H29NO6/c1-31-23-17-25(33-3)24(32-2)16-22(23)27(30)34-19-26(29)28(18-21-12-8-5-9-13-21)15-14-20-10-6-4-7-11-20/h4-13,16-17H,14-15,18-19H2,1-3H3 |
| InChIKey | UDKYMDWBMYMQGI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate?
The IUPAC name of [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate (CID 16528414) is [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate.
What is the SMILES notation for [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate?
The canonical SMILES for [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate is COc1cc(OC)c(C(=O)OCC(=O)N(CCc2ccccc2)Cc2ccccc2)cc1OC.
What is the InChIKey of [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate?
The InChIKey is UDKYMDWBMYMQGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29NO6/c1-31-23-17-25(33-3)24(32-2)16-22(23)27(30)34-19-26(29)28(18-21-12-8-5-9-13-21)15-14-20-10-6-4-7-11-20/h4-13,16-17H,14-15,18-19H2,1-3H3.
What are the key properties of [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate?
[2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate has a molecular weight of 463.53 g/mol, XLogP of 4.14, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[benzyl(2-phenylethyl)amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate is sourced from PubChem (CID 16528414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).