C24H25NO4S — CID 8808291
2-(4-acetyl-2-methoxyphenoxy)-N-(2-phenylethyl)-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 8808291) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is 2-(4-acetyl-2-methoxyphenoxy)-N-(2-phenylethyl)-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(4-acetyl-2-methoxyphenoxy)-N-(2-phenylethyl)-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 8808291 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2-(4-acetyl-2-methoxyphenoxy)-N-(2-phenylethyl)-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)N(CCc1ccccc1)Cc1cccs1 |
| InChI | InChI=1S/C24H25NO4S/c1-18(26)20-10-11-22(23(15-20)28-2)29-17-24(27)25(16-21-9-6-14-30-21)13-12-19-7-4-3-5-8-19/h3-11,14-15H,12-13,16-17H2,1-2H3 |
| InChIKey | MVLUFGCRLOIVSM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |