C19H18N2OS — CID 39911879
N-(2-phenylethyl)-N-(thiophen-2-ylmethyl)pyridine-4-carboxamide (PubChem CID 39911879) has the molecular formula C19H18N2OS and a molecular weight of 322.43 g/mol. Its IUPAC name is N-(2-phenylethyl)-N-(thiophen-2-ylmethyl)pyridine-4-carboxamide.
| Compound Name | N-(2-phenylethyl)-N-(thiophen-2-ylmethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 39911879 |
| Molecular Formula | C19H18N2OS |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-(2-phenylethyl)-N-(thiophen-2-ylmethyl)pyridine-4-carboxamide |
| SMILES | O=C(c1ccncc1)N(CCc1ccccc1)Cc1cccs1 |
| InChI | InChI=1S/C19H18N2OS/c22-19(17-8-11-20-12-9-17)21(15-18-7-4-14-23-18)13-10-16-5-2-1-3-6-16/h1-9,11-12,14H,10,13,15H2 |
| InChIKey | OIZLJVNGMGYLKO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |