C20H17F3N2OS — CID 121084904
N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)-4-(trifluoromethyl)benzamide (PubChem CID 121084904) has the molecular formula C20H17F3N2OS and a molecular weight of 390.43 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 121084904 |
| Molecular Formula | C20H17F3N2OS |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)-4-(trifluoromethyl)benzamide |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N(CCc1cccs1)Cc1cccnc1 |
| InChI | InChI=1S/C20H17F3N2OS/c21-20(22,23)17-7-5-16(6-8-17)19(26)25(11-9-18-4-2-12-27-18)14-15-3-1-10-24-13-15/h1-8,10,12-13H,9,11,14H2 |
| InChIKey | XQPAZYFDSMLNGY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |