C17H19F3N2 — CID 171910025
N-methyl-3-pyridin-3-yl-N-[[4-(trifluoromethyl)phenyl]methyl]propan-1-amine (PubChem CID 171910025) has the molecular formula C17H19F3N2 and a molecular weight of 308.35 g/mol. Its IUPAC name is N-methyl-3-pyridin-3-yl-N-[[4-(trifluoromethyl)phenyl]methyl]propan-1-amine.
| Compound Name | N-methyl-3-pyridin-3-yl-N-[[4-(trifluoromethyl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 171910025 |
| Molecular Formula | C17H19F3N2 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-methyl-3-pyridin-3-yl-N-[[4-(trifluoromethyl)phenyl]methyl]propan-1-amine |
| SMILES | CN(CCCc1cccnc1)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F3N2/c1-22(11-3-5-14-4-2-10-21-12-14)13-15-6-8-16(9-7-15)17(18,19)20/h2,4,6-10,12H,3,5,11,13H2,1H3 |
| InChIKey | INQMUYCJQVOUPM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |