C14H24N2 — CID 59176505
N,5-dimethyl-N-(pyridin-3-ylmethyl)hexan-1-amine (PubChem CID 59176505) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N,5-dimethyl-N-(pyridin-3-ylmethyl)hexan-1-amine.
| Compound Name | N,5-dimethyl-N-(pyridin-3-ylmethyl)hexan-1-amine |
|---|---|
| PubChem CID | 59176505 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N,5-dimethyl-N-(pyridin-3-ylmethyl)hexan-1-amine |
| SMILES | CC(C)CCCCN(C)Cc1cccnc1 |
| InChI | InChI=1S/C14H24N2/c1-13(2)7-4-5-10-16(3)12-14-8-6-9-15-11-14/h6,8-9,11,13H,4-5,7,10,12H2,1-3H3 |
| InChIKey | HCQAQDBKGROYPX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|