C10H15BrN2 — CID 61286516
3-bromo-N-methyl-N-(pyridin-3-ylmethyl)propan-1-amine (PubChem CID 61286516) has the molecular formula C10H15BrN2 and a molecular weight of 243.15 g/mol. Its IUPAC name is 3-bromo-N-methyl-N-(pyridin-3-ylmethyl)propan-1-amine.
| Compound Name | 3-bromo-N-methyl-N-(pyridin-3-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 61286516 |
| Molecular Formula | C10H15BrN2 |
| Molecular Weight | 243.15 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 3-bromo-N-methyl-N-(pyridin-3-ylmethyl)propan-1-amine |
| SMILES | CN(CCCBr)Cc1cccnc1 |
| InChI | InChI=1S/C10H15BrN2/c1-13(7-3-5-11)9-10-4-2-6-12-8-10/h2,4,6,8H,3,5,7,9H2,1H3 |
| InChIKey | JKGXKLHDBOVACT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.15 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|