C15H28N2OSi — CID 139923552
2-[tert-butyl(dimethyl)silyl]oxy-N-methyl-N-(pyridin-3-ylmethyl)ethanamine (PubChem CID 139923552) has the molecular formula C15H28N2OSi and a molecular weight of 280.49 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-N-methyl-N-(pyridin-3-ylmethyl)ethanamine.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-N-methyl-N-(pyridin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 139923552 |
| Molecular Formula | C15H28N2OSi |
| Molecular Weight | 280.49 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-N-methyl-N-(pyridin-3-ylmethyl)ethanamine |
| SMILES | CN(CCO[Si](C)(C)C(C)(C)C)Cc1cccnc1 |
| InChI | InChI=1S/C15H28N2OSi/c1-15(2,3)19(5,6)18-11-10-17(4)13-14-8-7-9-16-12-14/h7-9,12H,10-11,13H2,1-6H3 |
| InChIKey | SCAMKRDYQDVTNX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|