C12H22N2O7P2 — CID 19776429
[1-hydroxy-3-[methyl(3-pyridin-3-ylpropyl)amino]-1-phosphonopropyl]phosphonic acid (PubChem CID 19776429) has the molecular formula C12H22N2O7P2 and a molecular weight of 368.26 g/mol. Its IUPAC name is [1-hydroxy-3-[methyl(3-pyridin-3-ylpropyl)amino]-1-phosphonopropyl]phosphonic acid.
| Compound Name | [1-hydroxy-3-[methyl(3-pyridin-3-ylpropyl)amino]-1-phosphonopropyl]phosphonic acid |
|---|---|
| PubChem CID | 19776429 |
| Molecular Formula | C12H22N2O7P2 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [1-hydroxy-3-[methyl(3-pyridin-3-ylpropyl)amino]-1-phosphonopropyl]phosphonic acid |
| SMILES | CN(CCCc1cccnc1)CCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C12H22N2O7P2/c1-14(8-3-5-11-4-2-7-13-10-11)9-6-12(15,22(16,17)18)23(19,20)21/h2,4,7,10,15H,3,5-6,8-9H2,1H3,(H2,16,17,18)(H2,19,20,21) |
| InChIKey | CCDPZLSDSMXFPL-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|