C20H18F3N3OS — CID 121085047
1-(pyridin-3-ylmethyl)-1-(2-thiophen-2-ylethyl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 121085047) has the molecular formula C20H18F3N3OS and a molecular weight of 405.45 g/mol. Its IUPAC name is 1-(pyridin-3-ylmethyl)-1-(2-thiophen-2-ylethyl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(pyridin-3-ylmethyl)-1-(2-thiophen-2-ylethyl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 121085047 |
| Molecular Formula | C20H18F3N3OS |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 1-(pyridin-3-ylmethyl)-1-(2-thiophen-2-ylethyl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)N(CCc1cccs1)Cc1cccnc1 |
| InChI | InChI=1S/C20H18F3N3OS/c21-20(22,23)16-5-1-6-17(12-16)25-19(27)26(10-8-18-7-3-11-28-18)14-15-4-2-9-24-13-15/h1-7,9,11-13H,8,10,14H2,(H,25,27) |
| InChIKey | SDPZUIAEVKBPMJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |