C24H21F3N4O — CID 42695868
1-[2-(1H-indol-3-yl)ethyl]-1-(pyridin-4-ylmethyl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 42695868) has the molecular formula C24H21F3N4O and a molecular weight of 438.45 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-1-(pyridin-4-ylmethyl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-1-(pyridin-4-ylmethyl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 42695868 |
| Molecular Formula | C24H21F3N4O |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-1-(pyridin-4-ylmethyl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)N(CCc1c[nH]c2ccccc12)Cc1ccncc1 |
| InChI | InChI=1S/C24H21F3N4O/c25-24(26,27)19-4-3-5-20(14-19)30-23(32)31(16-17-8-11-28-12-9-17)13-10-18-15-29-22-7-2-1-6-21(18)22/h1-9,11-12,14-15,29H,10,13,16H2,(H,30,32) |
| InChIKey | MWHUJJMERHHZSW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |