C30H35N3O — CID 4264317
1-[(4-tert-butylphenyl)methyl]-3-(4-ethylphenyl)-1-[2-(1H-indol-3-yl)ethyl]urea (PubChem CID 4264317) has the molecular formula C30H35N3O and a molecular weight of 453.63 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-3-(4-ethylphenyl)-1-[2-(1H-indol-3-yl)ethyl]urea.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-3-(4-ethylphenyl)-1-[2-(1H-indol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 4264317 |
| Molecular Formula | C30H35N3O |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-3-(4-ethylphenyl)-1-[2-(1H-indol-3-yl)ethyl]urea |
| SMILES | CCc1ccc(NC(=O)N(CCc2c[nH]c3ccccc23)Cc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H35N3O/c1-5-22-12-16-26(17-13-22)32-29(34)33(21-23-10-14-25(15-11-23)30(2,3)4)19-18-24-20-31-28-9-7-6-8-27(24)28/h6-17,20,31H,5,18-19,21H2,1-4H3,(H,32,34) |
| InChIKey | LELUDJSGVSLEPE-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |