C25H23N3O3 — CID 42725646
1-(1,3-benzodioxol-5-ylmethyl)-1-[2-(1H-indol-3-yl)ethyl]-3-phenylurea (PubChem CID 42725646) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-1-[2-(1H-indol-3-yl)ethyl]-3-phenylurea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-[2-(1H-indol-3-yl)ethyl]-3-phenylurea |
|---|---|
| PubChem CID | 42725646 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-[2-(1H-indol-3-yl)ethyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N(CCc1c[nH]c2ccccc12)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H23N3O3/c29-25(27-20-6-2-1-3-7-20)28(16-18-10-11-23-24(14-18)31-17-30-23)13-12-19-15-26-22-9-5-4-8-21(19)22/h1-11,14-15,26H,12-13,16-17H2,(H,27,29) |
| InChIKey | KWBQOOKVDTWBRG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |