C25H21FN2O3 — CID 42725647
N-(1,3-benzodioxol-5-ylmethyl)-3-fluoro-N-[2-(1H-indol-3-yl)ethyl]benzamide (PubChem CID 42725647) has the molecular formula C25H21FN2O3 and a molecular weight of 416.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-fluoro-N-[2-(1H-indol-3-yl)ethyl]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-fluoro-N-[2-(1H-indol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 42725647 |
| Molecular Formula | C25H21FN2O3 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-fluoro-N-[2-(1H-indol-3-yl)ethyl]benzamide |
| SMILES | O=C(c1cccc(F)c1)N(CCc1c[nH]c2ccccc12)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H21FN2O3/c26-20-5-3-4-18(13-20)25(29)28(15-17-8-9-23-24(12-17)31-16-30-23)11-10-19-14-27-22-7-2-1-6-21(19)22/h1-9,12-14,27H,10-11,15-16H2 |
| InChIKey | OGTIRAWAFJEIJF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |