C26H24N2O3 — CID 139216201
2-(1,3-benzodioxol-5-yl)-N-benzyl-N-[2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 139216201) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-benzyl-N-[2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-benzyl-N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 139216201 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-benzyl-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N(CCc1c[nH]c2ccccc12)Cc1ccccc1 |
| InChI | InChI=1S/C26H24N2O3/c29-26(15-20-10-11-24-25(14-20)31-18-30-24)28(17-19-6-2-1-3-7-19)13-12-21-16-27-23-9-5-4-8-22(21)23/h1-11,14,16,27H,12-13,15,17-18H2 |
| InChIKey | MADIZJVSKFHFRH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |