C22H26N2O — CID 42695889
N-benzyl-N-[2-(1H-indol-3-yl)ethyl]pentanamide (PubChem CID 42695889) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is N-benzyl-N-[2-(1H-indol-3-yl)ethyl]pentanamide.
| Compound Name | N-benzyl-N-[2-(1H-indol-3-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 42695889 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | N-benzyl-N-[2-(1H-indol-3-yl)ethyl]pentanamide |
| SMILES | CCCCC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccccc1 |
| InChI | InChI=1S/C22H26N2O/c1-2-3-13-22(25)24(17-18-9-5-4-6-10-18)15-14-19-16-23-21-12-8-7-11-20(19)21/h4-12,16,23H,2-3,13-15,17H2,1H3 |
| InChIKey | OOKNBGDKACEIBZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |