C29H40N4O2 — CID 42772355
N-butyl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]butanamide (PubChem CID 42772355) has the molecular formula C29H40N4O2 and a molecular weight of 476.67 g/mol. Its IUPAC name is N-butyl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]butanamide.
| Compound Name | N-butyl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 42772355 |
| Molecular Formula | C29H40N4O2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | N-butyl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]butanamide |
| SMILES | CCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(N(C)C)cc1)C(=O)CCC |
| InChI | InChI=1S/C29H40N4O2/c1-5-7-18-32(28(34)10-6-2)22-29(35)33(21-23-13-15-25(16-14-23)31(3)4)19-17-24-20-30-27-12-9-8-11-26(24)27/h8-9,11-16,20,30H,5-7,10,17-19,21-22H2,1-4H3 |
| InChIKey | OBBXLNMIDJYSHI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|