C30H42N4O2 — CID 42777797
N-butan-2-yl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]pentanamide (PubChem CID 42777797) has the molecular formula C30H42N4O2 and a molecular weight of 490.69 g/mol. Its IUPAC name is N-butan-2-yl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]pentanamide.
| Compound Name | N-butan-2-yl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 42777797 |
| Molecular Formula | C30H42N4O2 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | N-butan-2-yl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]pentanamide |
| SMILES | CCCCC(=O)N(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(N(C)C)cc1)C(C)CC |
| InChI | InChI=1S/C30H42N4O2/c1-6-8-13-29(35)34(23(3)7-2)22-30(36)33(21-24-14-16-26(17-15-24)32(4)5)19-18-25-20-31-28-12-10-9-11-27(25)28/h9-12,14-17,20,23,31H,6-8,13,18-19,21-22H2,1-5H3 |
| InChIKey | OYCZPHMQLMEEMD-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|