C32H38N4O2 — CID 5041200
N-butan-2-yl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]benzamide (PubChem CID 5041200) has the molecular formula C32H38N4O2 and a molecular weight of 510.68 g/mol. Its IUPAC name is N-butan-2-yl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]benzamide.
| Compound Name | N-butan-2-yl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 5041200 |
| Molecular Formula | C32H38N4O2 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | N-butan-2-yl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]benzamide |
| SMILES | CCC(C)N(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(N(C)C)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C32H38N4O2/c1-5-24(2)36(32(38)26-11-7-6-8-12-26)23-31(37)35(22-25-15-17-28(18-16-25)34(3)4)20-19-27-21-33-30-14-10-9-13-29(27)30/h6-18,21,24,33H,5,19-20,22-23H2,1-4H3 |
| InChIKey | VUGCTUUTLNUKGE-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|