C32H37BrN4O2 — CID 3424112
3-bromo-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(2-methylpropyl)benzamide (PubChem CID 3424112) has the molecular formula C32H37BrN4O2 and a molecular weight of 589.58 g/mol. Its IUPAC name is 3-bromo-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(2-methylpropyl)benzamide.
| Compound Name | 3-bromo-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 3424112 |
| Molecular Formula | C32H37BrN4O2 |
| Molecular Weight | 589.58 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 3-bromo-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(N(C)C)cc1)C(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C32H37BrN4O2/c1-23(2)20-37(32(39)25-8-7-9-27(33)18-25)22-31(38)36(21-24-12-14-28(15-13-24)35(3)4)17-16-26-19-34-30-11-6-5-10-29(26)30/h5-15,18-19,23,34H,16-17,20-22H2,1-4H3 |
| InChIKey | LXJLMAPIBUKVPV-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.58 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|