C30H32N4O4 — CID 4136693
N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(2-methylpropyl)-3-nitrobenzamide (PubChem CID 4136693) has the molecular formula C30H32N4O4 and a molecular weight of 512.61 g/mol. Its IUPAC name is N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(2-methylpropyl)-3-nitrobenzamide.
| Compound Name | N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(2-methylpropyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 4136693 |
| Molecular Formula | C30H32N4O4 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(2-methylpropyl)-3-nitrobenzamide |
| SMILES | CC(C)CN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccccc1)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H32N4O4/c1-22(2)19-33(30(36)24-11-8-12-26(17-24)34(37)38)21-29(35)32(20-23-9-4-3-5-10-23)16-15-25-18-31-28-14-7-6-13-27(25)28/h3-14,17-18,22,31H,15-16,19-21H2,1-2H3 |
| InChIKey | OPUHVQNEAOVHHM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 99.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|