C29H38N4O2 — CID 42777887
N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-2-methyl-N-prop-2-enylbutanamide (PubChem CID 42777887) has the molecular formula C29H38N4O2 and a molecular weight of 474.65 g/mol. Its IUPAC name is N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-2-methyl-N-prop-2-enylbutanamide.
| Compound Name | N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-2-methyl-N-prop-2-enylbutanamide |
|---|---|
| PubChem CID | 42777887 |
| Molecular Formula | C29H38N4O2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-2-methyl-N-prop-2-enylbutanamide |
| SMILES | C=CCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(N(C)C)cc1)C(=O)C(C)CC |
| InChI | InChI=1S/C29H38N4O2/c1-6-17-33(29(35)22(3)7-2)21-28(34)32(20-23-12-14-25(15-13-23)31(4)5)18-16-24-19-30-27-11-9-8-10-26(24)27/h6,8-15,19,22,30H,1,7,16-18,20-21H2,2-5H3 |
| InChIKey | OGRUFWFAMKAXBZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|