C36H46N4O2 — CID 42777836
N-butan-2-yl-4-butyl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]benzamide (PubChem CID 42777836) has the molecular formula C36H46N4O2 and a molecular weight of 566.79 g/mol. Its IUPAC name is N-butan-2-yl-4-butyl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]benzamide.
| Compound Name | N-butan-2-yl-4-butyl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 42777836 |
| Molecular Formula | C36H46N4O2 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.36 |
| IUPAC Name | N-butan-2-yl-4-butyl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]benzamide |
| SMILES | CCCCc1ccc(C(=O)N(CC(=O)N(CCc2c[nH]c3ccccc23)Cc2ccc(N(C)C)cc2)C(C)CC)cc1 |
| InChI | InChI=1S/C36H46N4O2/c1-6-8-11-28-14-18-30(19-15-28)36(42)40(27(3)7-2)26-35(41)39(25-29-16-20-32(21-17-29)38(4)5)23-22-31-24-37-34-13-10-9-12-33(31)34/h9-10,12-21,24,27,37H,6-8,11,22-23,25-26H2,1-5H3 |
| InChIKey | IMZNGLBVICOIPU-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|