C34H42N4O4 — CID 42777830
N-butan-2-yl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-2,4-dimethoxybenzamide (PubChem CID 42777830) has the molecular formula C34H42N4O4 and a molecular weight of 570.73 g/mol. Its IUPAC name is N-butan-2-yl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-2,4-dimethoxybenzamide.
| Compound Name | N-butan-2-yl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 42777830 |
| Molecular Formula | C34H42N4O4 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | N-butan-2-yl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-2,4-dimethoxybenzamide |
| SMILES | CCC(C)N(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(N(C)C)cc1)C(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C34H42N4O4/c1-7-24(2)38(34(40)30-17-16-28(41-5)20-32(30)42-6)23-33(39)37(22-25-12-14-27(15-13-25)36(3)4)19-18-26-21-35-31-11-9-8-10-29(26)31/h8-17,20-21,24,35H,7,18-19,22-23H2,1-6H3 |
| InChIKey | BYUTURXFDLTDKN-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 78.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|