C38H42N4O4 — CID 42777881
N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3,4-dimethoxy-N-(2-phenylethyl)benzamide (PubChem CID 42777881) has the molecular formula C38H42N4O4 and a molecular weight of 618.78 g/mol. Its IUPAC name is N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3,4-dimethoxy-N-(2-phenylethyl)benzamide.
| Compound Name | N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3,4-dimethoxy-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 42777881 |
| Molecular Formula | C38H42N4O4 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3,4-dimethoxy-N-(2-phenylethyl)benzamide |
| SMILES | COc1ccc(C(=O)N(CCc2ccccc2)CC(=O)N(CCc2c[nH]c3ccccc23)Cc2ccc(N(C)C)cc2)cc1OC |
| InChI | InChI=1S/C38H42N4O4/c1-40(2)32-17-14-29(15-18-32)26-41(23-21-31-25-39-34-13-9-8-12-33(31)34)37(43)27-42(22-20-28-10-6-5-7-11-28)38(44)30-16-19-35(45-3)36(24-30)46-4/h5-19,24-25,39H,20-23,26-27H2,1-4H3 |
| InChIKey | IQCMTJIRUNRXQF-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 78.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|