C36H35F3N4O2 — CID 42777128
N-benzyl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 42777128) has the molecular formula C36H35F3N4O2 and a molecular weight of 612.70 g/mol. Its IUPAC name is N-benzyl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-benzyl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 42777128 |
| Molecular Formula | C36H35F3N4O2 |
| Molecular Weight | 612.70 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | N-benzyl-N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | CN(C)c1ccc(CN(CCc2c[nH]c3ccccc23)C(=O)CN(Cc2ccccc2)C(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C36H35F3N4O2/c1-41(2)31-17-15-27(16-18-31)23-42(20-19-29-22-40-33-14-7-6-13-32(29)33)34(44)25-43(24-26-9-4-3-5-10-26)35(45)28-11-8-12-30(21-28)36(37,38)39/h3-18,21-22,40H,19-20,23-25H2,1-2H3 |
| InChIKey | OZZMSAGFEQDRRZ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.70 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|