C32H31F6N3O3 — CID 4245747
N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 4245747) has the molecular formula C32H31F6N3O3 and a molecular weight of 619.61 g/mol. Its IUPAC name is N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 4245747 |
| Molecular Formula | C32H31F6N3O3 |
| Molecular Weight | 619.61 g/mol |
| Exact Mass | 619.23 |
| IUPAC Name | N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | COCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccccc1)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H31F6N3O3/c1-44-15-7-13-41(30(43)24-16-25(31(33,34)35)18-26(17-24)32(36,37)38)21-29(42)40(20-22-8-3-2-4-9-22)14-12-23-19-39-28-11-6-5-10-27(23)28/h2-6,8-11,16-19,39H,7,12-15,20-21H2,1H3 |
| InChIKey | KXACAFMFYUBJJX-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.61 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|