C31H34FN3O4 — CID 3320951
N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-methoxy-N-(3-methoxypropyl)benzamide (PubChem CID 3320951) has the molecular formula C31H34FN3O4 and a molecular weight of 531.63 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-methoxy-N-(3-methoxypropyl)benzamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-methoxy-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 3320951 |
| Molecular Formula | C31H34FN3O4 |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-methoxy-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(F)cc1)C(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C31H34FN3O4/c1-38-18-6-16-35(31(37)24-7-5-8-27(19-24)39-2)22-30(36)34(21-23-11-13-26(32)14-12-23)17-15-25-20-33-29-10-4-3-9-28(25)29/h3-5,7-14,19-20,33H,6,15-18,21-22H2,1-2H3 |
| InChIKey | FPNWLEFNZYJBEQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|