C31H34BrN3O4 — CID 5035247
4-bromo-N-[2-[2-(1H-indol-3-yl)ethyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide (PubChem CID 5035247) has the molecular formula C31H34BrN3O4 and a molecular weight of 592.53 g/mol. Its IUPAC name is 4-bromo-N-[2-[2-(1H-indol-3-yl)ethyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 4-bromo-N-[2-[2-(1H-indol-3-yl)ethyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 5035247 |
| Molecular Formula | C31H34BrN3O4 |
| Molecular Weight | 592.53 g/mol |
| Exact Mass | 591.17 |
| IUPAC Name | 4-bromo-N-[2-[2-(1H-indol-3-yl)ethyl-[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(OC)cc1)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C31H34BrN3O4/c1-38-19-5-17-35(31(37)24-10-12-26(32)13-11-24)22-30(36)34(21-23-8-14-27(39-2)15-9-23)18-16-25-20-33-29-7-4-3-6-28(25)29/h3-4,6-15,20,33H,5,16-19,21-22H2,1-2H3 |
| InChIKey | XRSPKBQTILEBCA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|