C32H36FN3O5 — CID 5060614
N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-2,4-dimethoxy-N-(3-methoxypropyl)benzamide (PubChem CID 5060614) has the molecular formula C32H36FN3O5 and a molecular weight of 561.65 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-2,4-dimethoxy-N-(3-methoxypropyl)benzamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-2,4-dimethoxy-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 5060614 |
| Molecular Formula | C32H36FN3O5 |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-2,4-dimethoxy-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(F)cc1)C(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C32H36FN3O5/c1-39-18-6-16-36(32(38)28-14-13-26(40-2)19-30(28)41-3)22-31(37)35(21-23-9-11-25(33)12-10-23)17-15-24-20-34-29-8-5-4-7-27(24)29/h4-5,7-14,19-20,34H,6,15-18,21-22H2,1-3H3 |
| InChIKey | CILDDFGYGCMKNZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 84.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|