C31H35N3O3 — CID 4169991
N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)-2-methylbenzamide (PubChem CID 4169991) has the molecular formula C31H35N3O3 and a molecular weight of 497.64 g/mol. Its IUPAC name is N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)-2-methylbenzamide.
| Compound Name | N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 4169991 |
| Molecular Formula | C31H35N3O3 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)-2-methylbenzamide |
| SMILES | COCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccccc1)C(=O)c1ccccc1C |
| InChI | InChI=1S/C31H35N3O3/c1-24-11-6-7-14-27(24)31(36)34(18-10-20-37-2)23-30(35)33(22-25-12-4-3-5-13-25)19-17-26-21-32-29-16-9-8-15-28(26)29/h3-9,11-16,21,32H,10,17-20,22-23H2,1-2H3 |
| InChIKey | IKQWNCMBUALNHU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|