C36H44FN3O3 — CID 4089723
N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-hexyl-N-(3-methoxypropyl)benzamide (PubChem CID 4089723) has the molecular formula C36H44FN3O3 and a molecular weight of 585.76 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-hexyl-N-(3-methoxypropyl)benzamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-hexyl-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 4089723 |
| Molecular Formula | C36H44FN3O3 |
| Molecular Weight | 585.76 g/mol |
| Exact Mass | 585.34 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-hexyl-N-(3-methoxypropyl)benzamide |
| SMILES | CCCCCCc1ccc(C(=O)N(CCCOC)CC(=O)N(CCc2c[nH]c3ccccc23)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C36H44FN3O3/c1-3-4-5-6-10-28-13-17-30(18-14-28)36(42)40(22-9-24-43-2)27-35(41)39(26-29-15-19-32(37)20-16-29)23-21-31-25-38-34-12-8-7-11-33(31)34/h7-8,11-20,25,38H,3-6,9-10,21-24,26-27H2,1-2H3 |
| InChIKey | PZDGEPORKYYOLI-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.76 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|