C30H33FN4O3 — CID 4122876
N-[(4-fluorophenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[3-methoxypropyl(phenylcarbamoyl)amino]acetamide (PubChem CID 4122876) has the molecular formula C30H33FN4O3 and a molecular weight of 516.62 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[3-methoxypropyl(phenylcarbamoyl)amino]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[3-methoxypropyl(phenylcarbamoyl)amino]acetamide |
|---|---|
| PubChem CID | 4122876 |
| Molecular Formula | C30H33FN4O3 |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[3-methoxypropyl(phenylcarbamoyl)amino]acetamide |
| SMILES | COCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(F)cc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C30H33FN4O3/c1-38-19-7-17-35(30(37)33-26-8-3-2-4-9-26)22-29(36)34(21-23-12-14-25(31)15-13-23)18-16-24-20-32-28-11-6-5-10-27(24)28/h2-6,8-15,20,32H,7,16-19,21-22H2,1H3,(H,33,37) |
| InChIKey | BEINZPUKEOBNHB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|