C30H38FN3O3 — CID 3593629
N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)cyclohexanecarboxamide (PubChem CID 3593629) has the molecular formula C30H38FN3O3 and a molecular weight of 507.65 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)cyclohexanecarboxamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 3593629 |
| Molecular Formula | C30H38FN3O3 |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)cyclohexanecarboxamide |
| SMILES | COCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(F)cc1)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C30H38FN3O3/c1-37-19-7-17-34(30(36)24-8-3-2-4-9-24)22-29(35)33(21-23-12-14-26(31)15-13-23)18-16-25-20-32-28-11-6-5-10-27(25)28/h5-6,10-15,20,24,32H,2-4,7-9,16-19,21-22H2,1H3 |
| InChIKey | XJEJIAQPTTWYHT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|