C31H32FN5O3 — CID 4089724
2-[(4-cyanophenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(4-fluorophenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 4089724) has the molecular formula C31H32FN5O3 and a molecular weight of 541.63 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(4-fluorophenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-[(4-cyanophenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(4-fluorophenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 4089724 |
| Molecular Formula | C31H32FN5O3 |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | 2-[(4-cyanophenyl)carbamoyl-(3-methoxypropyl)amino]-N-[(4-fluorophenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | COCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(F)cc1)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C31H32FN5O3/c1-40-18-4-16-37(31(39)35-27-13-9-23(19-33)10-14-27)22-30(38)36(21-24-7-11-26(32)12-8-24)17-15-25-20-34-29-6-3-2-5-28(25)29/h2-3,5-14,20,34H,4,15-18,21-22H2,1H3,(H,35,39) |
| InChIKey | VJUFANCXRWISMC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|