C33H41N5O3S — CID 42772419
N-[[4-(dimethylamino)phenyl]methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[3-methoxypropyl-[(4-methylsulfanylphenyl)carbamoyl]amino]acetamide (PubChem CID 42772419) has the molecular formula C33H41N5O3S and a molecular weight of 587.79 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[3-methoxypropyl-[(4-methylsulfanylphenyl)carbamoyl]amino]acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[3-methoxypropyl-[(4-methylsulfanylphenyl)carbamoyl]amino]acetamide |
|---|---|
| PubChem CID | 42772419 |
| Molecular Formula | C33H41N5O3S |
| Molecular Weight | 587.79 g/mol |
| Exact Mass | 587.29 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[3-methoxypropyl-[(4-methylsulfanylphenyl)carbamoyl]amino]acetamide |
| SMILES | COCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(N(C)C)cc1)C(=O)Nc1ccc(SC)cc1 |
| InChI | InChI=1S/C33H41N5O3S/c1-36(2)28-14-10-25(11-15-28)23-37(20-18-26-22-34-31-9-6-5-8-30(26)31)32(39)24-38(19-7-21-41-3)33(40)35-27-12-16-29(42-4)17-13-27/h5-6,8-17,22,34H,7,18-21,23-24H2,1-4H3,(H,35,40) |
| InChIKey | WGHHQWHHHHHCPC-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.79 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|