C32H37Cl2N5O3 — CID 42772417
2-[(2,3-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]-N-[[4-(dimethylamino)phenyl]methyl]-N-[2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 42772417) has the molecular formula C32H37Cl2N5O3 and a molecular weight of 610.59 g/mol. Its IUPAC name is 2-[(2,3-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]-N-[[4-(dimethylamino)phenyl]methyl]-N-[2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-[(2,3-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]-N-[[4-(dimethylamino)phenyl]methyl]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 42772417 |
| Molecular Formula | C32H37Cl2N5O3 |
| Molecular Weight | 610.59 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | 2-[(2,3-dichlorophenyl)carbamoyl-(3-methoxypropyl)amino]-N-[[4-(dimethylamino)phenyl]methyl]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | COCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(N(C)C)cc1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C32H37Cl2N5O3/c1-37(2)25-14-12-23(13-15-25)21-38(18-16-24-20-35-28-10-5-4-8-26(24)28)30(40)22-39(17-7-19-42-3)32(41)36-29-11-6-9-27(33)31(29)34/h4-6,8-15,20,35H,7,16-19,21-22H2,1-3H3,(H,36,41) |
| InChIKey | HPXFVXQYUGQZRO-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.59 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|