C26H32Cl2N4O3 — CID 3416755
N-[(3,4-dichlorophenyl)methyl]-2-[dimethylcarbamoyl(3-methoxypropyl)amino]-N-[2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 3416755) has the molecular formula C26H32Cl2N4O3 and a molecular weight of 519.47 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-2-[dimethylcarbamoyl(3-methoxypropyl)amino]-N-[2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-2-[dimethylcarbamoyl(3-methoxypropyl)amino]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 3416755 |
| Molecular Formula | C26H32Cl2N4O3 |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-2-[dimethylcarbamoyl(3-methoxypropyl)amino]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | COCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(Cl)c(Cl)c1)C(=O)N(C)C |
| InChI | InChI=1S/C26H32Cl2N4O3/c1-30(2)26(34)32(12-6-14-35-3)18-25(33)31(17-19-9-10-22(27)23(28)15-19)13-11-20-16-29-24-8-5-4-7-21(20)24/h4-5,7-10,15-16,29H,6,11-14,17-18H2,1-3H3 |
| InChIKey | PCEQSRMCBDVEKE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|