C30H30BrCl2N3O3 — CID 3612524
3-bromo-N-[2-[(3,4-dichlorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide (PubChem CID 3612524) has the molecular formula C30H30BrCl2N3O3 and a molecular weight of 631.40 g/mol. Its IUPAC name is 3-bromo-N-[2-[(3,4-dichlorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 3-bromo-N-[2-[(3,4-dichlorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 3612524 |
| Molecular Formula | C30H30BrCl2N3O3 |
| Molecular Weight | 631.40 g/mol |
| Exact Mass | 629.08 |
| IUPAC Name | 3-bromo-N-[2-[(3,4-dichlorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(Cl)c(Cl)c1)C(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C30H30BrCl2N3O3/c1-39-15-5-13-36(30(38)22-6-4-7-24(31)17-22)20-29(37)35(19-21-10-11-26(32)27(33)16-21)14-12-23-18-34-28-9-3-2-8-25(23)28/h2-4,6-11,16-18,34H,5,12-15,19-20H2,1H3 |
| InChIKey | KXKMZEKIMYLLTD-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.40 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|