C33H39N3O5 — CID 4066836
N-[2-[(4-ethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-methoxy-N-(3-methoxypropyl)benzamide (PubChem CID 4066836) has the molecular formula C33H39N3O5 and a molecular weight of 557.69 g/mol. Its IUPAC name is N-[2-[(4-ethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-methoxy-N-(3-methoxypropyl)benzamide.
| Compound Name | N-[2-[(4-ethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-methoxy-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 4066836 |
| Molecular Formula | C33H39N3O5 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | N-[2-[(4-ethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-methoxy-N-(3-methoxypropyl)benzamide |
| SMILES | CCOc1ccc(CN(CCc2c[nH]c3ccccc23)C(=O)CN(CCCOC)C(=O)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C33H39N3O5/c1-4-41-28-15-13-25(14-16-28)23-35(19-17-27-22-34-31-12-6-5-11-30(27)31)32(37)24-36(18-8-20-39-2)33(38)26-9-7-10-29(21-26)40-3/h5-7,9-16,21-22,34H,4,8,17-20,23-24H2,1-3H3 |
| InChIKey | RAISQFCIRGXOHS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 84.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|