C31H33Cl2N3O4 — CID 3567855
N-[2-[(3,4-dichlorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-methoxy-N-(3-methoxypropyl)benzamide (PubChem CID 3567855) has the molecular formula C31H33Cl2N3O4 and a molecular weight of 582.53 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-methoxy-N-(3-methoxypropyl)benzamide.
| Compound Name | N-[2-[(3,4-dichlorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-methoxy-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 3567855 |
| Molecular Formula | C31H33Cl2N3O4 |
| Molecular Weight | 582.53 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | N-[2-[(3,4-dichlorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-methoxy-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(Cl)c(Cl)c1)C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C31H33Cl2N3O4/c1-39-17-5-15-36(31(38)23-9-11-25(40-2)12-10-23)21-30(37)35(20-22-8-13-27(32)28(33)18-22)16-14-24-19-34-29-7-4-3-6-26(24)29/h3-4,6-13,18-19,34H,5,14-17,20-21H2,1-2H3 |
| InChIKey | YYOUITOEXXKDSD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.53 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|