C32H33Cl2N3O2 — CID 5157043
N-butyl-N-[2-[(3,4-dichlorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-phenylprop-2-enamide (PubChem CID 5157043) has the molecular formula C32H33Cl2N3O2 and a molecular weight of 562.54 g/mol. Its IUPAC name is N-butyl-N-[2-[(3,4-dichlorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-phenylprop-2-enamide.
| Compound Name | N-butyl-N-[2-[(3,4-dichlorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 5157043 |
| Molecular Formula | C32H33Cl2N3O2 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | N-butyl-N-[2-[(3,4-dichlorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-3-phenylprop-2-enamide |
| SMILES | CCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(Cl)c(Cl)c1)C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C32H33Cl2N3O2/c1-2-3-18-36(31(38)16-14-24-9-5-4-6-10-24)23-32(39)37(22-25-13-15-28(33)29(34)20-25)19-17-26-21-35-30-12-8-7-11-27(26)30/h4-16,20-21,35H,2-3,17-19,22-23H2,1H3 |
| InChIKey | MQQNHPAJNAJLJU-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|