C32H35N3O2 — CID 3468318
N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-butyl-3-phenylprop-2-enamide (PubChem CID 3468318) has the molecular formula C32H35N3O2 and a molecular weight of 493.65 g/mol. Its IUPAC name is N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-butyl-3-phenylprop-2-enamide.
| Compound Name | N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-butyl-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 3468318 |
| Molecular Formula | C32H35N3O2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-butyl-3-phenylprop-2-enamide |
| SMILES | CCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccccc1)C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C32H35N3O2/c1-2-3-21-34(31(36)19-18-26-12-6-4-7-13-26)25-32(37)35(24-27-14-8-5-9-15-27)22-20-28-23-33-30-17-11-10-16-29(28)30/h4-19,23,33H,2-3,20-22,24-25H2,1H3 |
| InChIKey | WAUWZBKHRNAQSZ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|